CAS 2605899-29-2 is the registry number for 5-Iodo-1,6-dimethyl-4-(trifluoromethyl)pyridin-2(1H)-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-iodo-1,6-dimethyl-4-(trifluoromethyl)pyridin-2-one (CAS 2605899-29-2) is a chemical compound with the molecular formula C8H7F3INO and a molecular weight of 317.05 g/mol. IUPAC name: 5-iodo-1,6-dimethyl-4-(trifluoromethyl)pyridin-2-one. InChIKey: UGALAMSNOFRLSE-UHFFFAOYSA-N.
| Molecular formula | C8H7F3INO |
|---|---|
| Molecular weight | 317.05 g/mol |
| IUPAC name | 5-iodo-1,6-dimethyl-4-(trifluoromethyl)pyridin-2-one |
| InChIKey | UGALAMSNOFRLSE-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=CC(=O)N1C)C(F)(F)F)I |
Computed by PubChem (NCBI)