Products 26063-96-7
CAS 26063-96-7 appears in our catalog under these names: 3–Isomangostin hydrate, 3-Isomangostin hydrate, 99.47%. Offered by: GLPBio, MedChemExpress. Available pack sizes: 1mg, 5mg, 1 mg, 5 mg.
5,9-dihydroxy-7-(3-hydroxy-3-methylbutyl)-8-methoxy-2,2-dimethyl-3,4-dihydropyrano[3,2-b]xanthen-6-one (CAS 26063-96-7) is a chemical compound with the molecular formula C24H28O7 and a molecular weight of 428.5 g/mol. IUPAC name: 5,9-dihydroxy-7-(3-hydroxy-3-methylbutyl)-8-methoxy-2,2-dimethyl-3,4-dihydropyrano[3,2-b]xanthen-6-one. InChIKey: REZOIULTUMSCRT-UHFFFAOYSA-N.
| Molecular formula | C24H28O7 |
|---|---|
| Molecular weight | 428.5 g/mol |
| IUPAC name | 5,9-dihydroxy-7-(3-hydroxy-3-methylbutyl)-8-methoxy-2,2-dimethyl-3,4-dihydropyrano[3,2-b]xanthen-6-one |
| InChIKey | REZOIULTUMSCRT-UHFFFAOYSA-N |
| SMILES | CC1(CCC2=C(O1)C=C3C(=C2O)C(=O)C4=C(O3)C=C(C(=C4CCC(C)(C)O)OC)O)C |
Computed by PubChem (NCBI)
Synonyms:
3-Isomangostin Hydrate, orb1683589