CAS 2607106-18-1 appears in our catalog under these names: Formamidine tetrafluoroborate, 95%, Formamidinium Tetrafluoroborate, >98.0%(N). Offered by: Combi-blocks, TCI. Available pack sizes: 250mg, 5g, 1g.
Aminomethylideneazanium tetrafluoroborate (CAS 2607106-18-1) is a chemical compound with the molecular formula CH5BF4N2 and a molecular weight of 131.87 g/mol. IUPAC name: aminomethylideneazanium tetrafluoroborate. InChIKey: LVVJQPMLINTBPA-UHFFFAOYSA-O.
| Molecular formula | CH5BF4N2 |
|---|---|
| Molecular weight | 131.87 g/mol |
| IUPAC name | aminomethylideneazanium tetrafluoroborate |
| InChIKey | LVVJQPMLINTBPA-UHFFFAOYSA-O |
| SMILES | [B-](F)(F)(F)F.C(=[NH2+])N |
Computed by PubChem (NCBI)