CAS 2607137-43-7 is the registry number for 1-tert-Butyl 2-methyl (2S,4R)-4-(4-nitrophenoxy)pyrrolidine-1,2-dicarboxylate, 96%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
1-O-tert-butyl 2-O-methyl (2S,4R)-4-(4-nitrophenoxy)pyrrolidine-1,2-dicarboxylate (CAS 2607137-43-7) is a chemical compound with the molecular formula C17H22N2O7 and a molecular weight of 366.4 g/mol. IUPAC name: 1-O-tert-butyl 2-O-methyl (2S,4R)-4-(4-nitrophenoxy)pyrrolidine-1,2-dicarboxylate. InChIKey: DNHWLQXEEIRMRR-KGLIPLIRSA-N.
| Molecular formula | C17H22N2O7 |
|---|---|
| Molecular weight | 366.4 g/mol |
| IUPAC name | 1-O-tert-butyl 2-O-methyl (2S,4R)-4-(4-nitrophenoxy)pyrrolidine-1,2-dicarboxylate |
| InChIKey | DNHWLQXEEIRMRR-KGLIPLIRSA-N |
| SMILES | CC(C)(C)OC(=O)N1C[C@@H](C[C@H]1C(=O)OC)OC2=CC=C(C=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)