Products 26076-46-0

CAS 26076-46-0 appears in our catalog under these names: 2,5-Thiophenediboronic acid, 96%, 2,5–Thiophenediylbisboronic acid(contains varying amounts of Anhydride), 2,5-Thiophenediylbisboronic acid 98%, 2,5-THIOPHENEDIYLBISBORONIC ACID, >=95.&, Thiophene-2,5-diyldiboronic acid, 98%, 98%. Offered by: Combi-blocks, GLPBio, Ambeed, Sigma-Aldrich, Chemat. Available pack sizes: 5g, 10g, 1g, 25g, 100g.

Structural formula: {0} (CAS {1})

(5-boronothiophen-2-yl)boronic acid (CAS 26076-46-0) is a chemical compound with the molecular formula C4H6B2O4S and a molecular weight of 171.8 g/mol. IUPAC name: (5-boronothiophen-2-yl)boronic acid. InChIKey: SKFDVFMUXZWWOW-UHFFFAOYSA-N.

Identity
Molecular formulaC4H6B2O4S
Molecular weight171.8 g/mol
IUPAC name(5-boronothiophen-2-yl)boronic acid
InChIKeySKFDVFMUXZWWOW-UHFFFAOYSA-N
SMILESB(C1=CC=C(S1)B(O)O)(O)O

Computed by PubChem (NCBI)