CAS 26084-35-5 is the registry number for 1,3-Bis-(1,5-dimethyl-3-oxo-2-phenyl-2,3-dihydro-1h-pyrazol-4-yl)-thiourea, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
1,3-bis(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)thiourea (CAS 26084-35-5) is a chemical compound with the molecular formula C23H24N6O2S and a molecular weight of 448.5 g/mol. IUPAC name: 1,3-bis(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)thiourea. InChIKey: XNUJOLWSNBYUIF-UHFFFAOYSA-N.
| Molecular formula | C23H24N6O2S |
|---|---|
| Molecular weight | 448.5 g/mol |
| IUPAC name | 1,3-bis(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)thiourea |
| InChIKey | XNUJOLWSNBYUIF-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=O)N(N1C)C2=CC=CC=C2)NC(=S)NC3=C(N(N(C3=O)C4=CC=CC=C4)C)C |
Computed by PubChem (NCBI)