CAS 2609643-50-5 is the registry number for 4,6-Dichloro-5-fluoronicotinamide, 95%. Offered by: AmBeed. Available pack sizes: 1g, 5g.
4,6-dichloro-5-fluoropyridine-3-carboxamide (CAS 2609643-50-5) is a chemical compound with the molecular formula C6H3Cl2FN2O and a molecular weight of 209.00 g/mol. IUPAC name: 4,6-dichloro-5-fluoropyridine-3-carboxamide. InChIKey: XCSDBSIHRUTJGG-UHFFFAOYSA-N.
| Molecular formula | C6H3Cl2FN2O |
|---|---|
| Molecular weight | 209.00 g/mol |
| IUPAC name | 4,6-dichloro-5-fluoropyridine-3-carboxamide |
| InChIKey | XCSDBSIHRUTJGG-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C(=N1)Cl)F)Cl)C(=O)N |
Computed by PubChem (NCBI)