CAS 2611-67-8 appears in our catalog under these names: Cyanin Chloride, Cyanin Chloride, Cyanidin-3,5-di-O-glucoside, 3,5-Bis(glucosyloxy)-3',4',7-trihydroxyflavylium chloride, 99%, 99%, Cyanin chloride, ROTICHROM® HPLC, 20 mg, glass. Offered by: TRC, GLPBio, Biosynth, Sigma-Aldrich, Chemat. Available pack sizes: 250mg, 100mg, 25mg, 5mg, 2mg, 1MG, 20mg, 50mg.
2-(3,4-dihydroxyphenyl)-3,5-bis[[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy]chromen-7-one (CAS 2611-67-8) is a chemical compound with the molecular formula C27H30O16 and a molecular weight of 610.5 g/mol. IUPAC name: 2-(3,4-dihydroxyphenyl)-3,5-bis[[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy]chromen-7-one. InChIKey: MVCZYIINCNBXDB-UHFFFAOYSA-N.
| Molecular formula | C27H30O16 |
|---|---|
| Molecular weight | 610.5 g/mol |
| IUPAC name | 2-(3,4-dihydroxyphenyl)-3,5-bis[[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy]chromen-7-one |
| InChIKey | MVCZYIINCNBXDB-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C2=C(C=C3C(=CC(=O)C=C3OC4C(C(C(C(O4)CO)O)O)O)O2)OC5C(C(C(C(O5)CO)O)O)O)O)O |
Computed by PubChem (NCBI)