CAS 26117-20-4 appears in our catalog under these names: (2S)-2-(Carbamoylamino)-4-methylpentanoic acid, (S)-4-Methyl-2-ureidopentanoic acid, 97%, Carbamoyl-Leu-OH. Offered by: Biosynth, AmBeed, Creative Peptides. Available pack sizes: 50mg, 0,5g, 5g, 1g.
(2S)-2-(carbamoylamino)-4-methylpentanoic acid (CAS 26117-20-4) is a chemical compound with the molecular formula C7H14N2O3 and a molecular weight of 174.20 g/mol. IUPAC name: (2S)-2-(carbamoylamino)-4-methylpentanoic acid. InChIKey: JUIBQJHHPDRAGP-YFKPBYRVSA-N.
| Molecular formula | C7H14N2O3 |
|---|---|
| Molecular weight | 174.20 g/mol |
| IUPAC name | (2S)-2-(carbamoylamino)-4-methylpentanoic acid |
| InChIKey | JUIBQJHHPDRAGP-YFKPBYRVSA-N |
| SMILES | CC(C)C[C@@H](C(=O)O)NC(=O)N |
Computed by PubChem (NCBI)