CAS 2613382-73-1 is the registry number for tert-Butyl 5-((6-chloropyrazin-2-yl)amino)-7-azaspiro(3.5)nonane-7-carboxylate, 95%. Offered by: AmBeed. Available pack sizes: 1g.
Tert-butyl 9-[(6-chloropyrazin-2-yl)amino]-7-azaspiro[3.5]nonane-7-carboxylate (CAS 2613382-73-1) is a chemical compound with the molecular formula C17H25ClN4O2 and a molecular weight of 352.9 g/mol. IUPAC name: tert-butyl 9-[(6-chloropyrazin-2-yl)amino]-7-azaspiro[3.5]nonane-7-carboxylate. InChIKey: VCHPSELUVVLFDC-UHFFFAOYSA-N.
| Molecular formula | C17H25ClN4O2 |
|---|---|
| Molecular weight | 352.9 g/mol |
| IUPAC name | tert-butyl 9-[(6-chloropyrazin-2-yl)amino]-7-azaspiro[3.5]nonane-7-carboxylate |
| InChIKey | VCHPSELUVVLFDC-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC2(CCC2)C(C1)NC3=CN=CC(=N3)Cl |
Computed by PubChem (NCBI)