CAS 261503-44-0 is the registry number for 1H-Heptafluoro-3,3-bis(trifluoromethyl)-1-hexyne, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
4,4,5,5,6,6,6-heptafluoro-3,3-bis(trifluoromethyl)hex-1-yne (CAS 261503-44-0) is a chemical compound with the molecular formula C8HF13 and a molecular weight of 344.07 g/mol. IUPAC name: 4,4,5,5,6,6,6-heptafluoro-3,3-bis(trifluoromethyl)hex-1-yne. InChIKey: UEYXJPFQJDFMGD-UHFFFAOYSA-N.
| Molecular formula | C8HF13 |
|---|---|
| Molecular weight | 344.07 g/mol |
| IUPAC name | 4,4,5,5,6,6,6-heptafluoro-3,3-bis(trifluoromethyl)hex-1-yne |
| InChIKey | UEYXJPFQJDFMGD-UHFFFAOYSA-N |
| SMILES | C#CC(C(C(C(F)(F)F)(F)F)(F)F)(C(F)(F)F)C(F)(F)F |
Computed by PubChem (NCBI)