CAS 261505-81-1 appears in our catalog under these names: BIIB 722 Mesylate/ 99.49% (existing batch purity), Sabiporide (mesylate). Offered by: TargetMol, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 10 mg, 5 mg.
N-(diaminomethylidene)-4-[4-(1H-pyrrole-2-carbonyl)piperazin-1-yl]-3-(trifluoromethyl)benzamide;methanesulfonic acid (CAS 261505-81-1) is a chemical compound with the molecular formula C19H23F3N6O5S and a molecular weight of 504.5 g/mol. IUPAC name: N-(diaminomethylidene)-4-[4-(1H-pyrrole-2-carbonyl)piperazin-1-yl]-3-(trifluoromethyl)benzamide;methanesulfonic acid. InChIKey: LLHGICOEFFAEBO-UHFFFAOYSA-N.
| Molecular formula | C19H23F3N6O5S |
|---|---|
| Molecular weight | 504.5 g/mol |
| IUPAC name | N-(diaminomethylidene)-4-[4-(1H-pyrrole-2-carbonyl)piperazin-1-yl]-3-(trifluoromethyl)benzamide;methanesulfonic acid |
| InChIKey | LLHGICOEFFAEBO-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)O.C1CN(CCN1C2=C(C=C(C=C2)C(=O)N=C(N)N)C(F)(F)F)C(=O)C3=CC=CN3 |
Computed by PubChem (NCBI)