Products 2615254-55-0
CAS 2615254-55-0 is the registry number for Antibacterial agent 123. Offered by: MedChemExpress. Available pack sizes: Get quote.
2,7-bis(trifluoromethyl)-5-[[5-(trifluoromethyl)-2-pyridinyl]amino]-1H-quinolin-4-one (CAS 2615254-55-0) is a chemical compound with the molecular formula C17H8F9N3O and a molecular weight of 441.25 g/mol. IUPAC name: 2,7-bis(trifluoromethyl)-5-[[5-(trifluoromethyl)-2-pyridinyl]amino]-1H-quinolin-4-one. InChIKey: RYODTJWRFFACTO-UHFFFAOYSA-N.
| Molecular formula | C17H8F9N3O |
|---|---|
| Molecular weight | 441.25 g/mol |
| IUPAC name | 2,7-bis(trifluoromethyl)-5-[[5-(trifluoromethyl)-2-pyridinyl]amino]-1H-quinolin-4-one |
| InChIKey | RYODTJWRFFACTO-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC=C1C(F)(F)F)NC2=CC(=CC3=C2C(=O)C=C(N3)C(F)(F)F)C(F)(F)F |
Computed by PubChem (NCBI)
Synonyms:
Antibacterial agent 123, orb1982446