CAS 2615912-33-7 appears in our catalog under these names: αvβ5 integrin-IN-1, αvβ5 integrin–IN–1, αvβ5 integrin-IN-1, 99%, 99%, αvβ5 integrin-IN-1, 99.28%. Offered by: TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: 1mg, 10mg, 5mg, 25 mg, 5 mg, 50 mg, 10 mg, 100 mg.
(3S)-4-oxo-4-[(3R)-3-[2-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)ethyl]pyrrolidin-1-yl]-3-[3-(trifluoromethyl)phenyl]butanoic acid (CAS 2615912-33-7) is a chemical compound with the molecular formula C25H28F3N3O3 and a molecular weight of 475.5 g/mol. IUPAC name: (3S)-4-oxo-4-[(3R)-3-[2-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)ethyl]pyrrolidin-1-yl]-3-[3-(trifluoromethyl)phenyl]butanoic acid. InChIKey: NUPIGKKRXBENIY-IERDGZPVSA-N.
| Molecular formula | C25H28F3N3O3 |
|---|---|
| Molecular weight | 475.5 g/mol |
| IUPAC name | (3S)-4-oxo-4-[(3R)-3-[2-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)ethyl]pyrrolidin-1-yl]-3-[3-(trifluoromethyl)phenyl]butanoic acid |
| InChIKey | NUPIGKKRXBENIY-IERDGZPVSA-N |
| SMILES | C1CC2=C(NC1)N=C(C=C2)CC[C@@H]3CCN(C3)C(=O)[C@@H](CC(=O)O)C4=CC(=CC=C4)C(F)(F)F |
Computed by PubChem (NCBI)