CAS 2616-72-0 appears in our catalog under these names: Naphthol as-tr phosphate, 95%, Naphthol AS-TR Phosphate, Naphthol AS–TR Phosphate, 3-((4-Chloro-2-methylphenyl)carbamoyl)naphthalen-2-yl dihydrogen phosphate, Naphthol AS-TR phosphate, min. 90 %, 250 mg. Offered by: Combi-blocks, TRC, GLPBio, Biosynth, Chemat. Available pack sizes: 250mg, 1g, 5g, 200mg, 50mg, 500mg, 1000mg, 2000mg.
[3-[(4-chloro-2-methylphenyl)carbamoyl]naphthalen-2-yl] dihydrogen phosphate (CAS 2616-72-0) is a chemical compound with the molecular formula C18H15ClNO5P and a molecular weight of 391.7 g/mol. IUPAC name: [3-[(4-chloro-2-methylphenyl)carbamoyl]naphthalen-2-yl] dihydrogen phosphate. InChIKey: SHTFMUPUBYXPCD-UHFFFAOYSA-N.
| Molecular formula | C18H15ClNO5P |
|---|---|
| Molecular weight | 391.7 g/mol |
| IUPAC name | [3-[(4-chloro-2-methylphenyl)carbamoyl]naphthalen-2-yl] dihydrogen phosphate |
| InChIKey | SHTFMUPUBYXPCD-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)Cl)NC(=O)C2=CC3=CC=CC=C3C=C2OP(=O)(O)O |
Computed by PubChem (NCBI)