CAS 261705-15-1 is the registry number for 2-(4-(tert-Butyl)benzoyl)-N-phenylhydrazinecarbothioamide, 95+%. Offered by: Chemat Brand. Available pack sizes: on request.
1-[(4-tert-butylbenzoyl)amino]-3-phenylthiourea (CAS 261705-15-1) is a chemical compound with the molecular formula C18H21N3OS and a molecular weight of 327.4 g/mol. IUPAC name: 1-[(4-tert-butylbenzoyl)amino]-3-phenylthiourea. InChIKey: QSNVIWCZBYUWFG-UHFFFAOYSA-N.
| Molecular formula | C18H21N3OS |
|---|---|
| Molecular weight | 327.4 g/mol |
| IUPAC name | 1-[(4-tert-butylbenzoyl)amino]-3-phenylthiourea |
| InChIKey | QSNVIWCZBYUWFG-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC=C(C=C1)C(=O)NNC(=S)NC2=CC=CC=C2 |
Computed by PubChem (NCBI)