CAS 2618458-93-6 appears in our catalog under these names: Mevalonate (lithium salt), Mevalonic acid lithium salt, Mevalonic acid (lithium salt), 99.80%, Mevalonic acid (lithium salt) (Standard). Offered by: GLPBio, MedChemExpress. Available pack sizes: 1mg, 5mg, 500μg, 10mM/1mL, 250 mg, 500 mg, 50 mg, 100 mg.
Lithium 3,5-dihydroxy-3-methylpentanoate (CAS 2618458-93-6) is a chemical compound with the molecular formula C6H11LiO4 and a molecular weight of 154.1 g/mol. IUPAC name: lithium 3,5-dihydroxy-3-methylpentanoate. InChIKey: PVWNXFFXFNEHDZ-UHFFFAOYSA-M.
| Molecular formula | C6H11LiO4 |
|---|---|
| Molecular weight | 154.1 g/mol |
| IUPAC name | lithium 3,5-dihydroxy-3-methylpentanoate |
| InChIKey | PVWNXFFXFNEHDZ-UHFFFAOYSA-M |
| SMILES | [Li+].CC(CCO)(CC(=O)[O-])O |
Computed by PubChem (NCBI)