CAS 261928-97-6 appears in our catalog under these names: 3-[(2,6-Dichlorobenzyl)sulfanyl]-1h-1,2,4-triazol-5-amine, 95%, 3-{((2,6-Dichlorophenyl)methyl)sulfanyl}-1H-1,2,4-triazol-5-amine. Offered by: Combi-blocks, Biosynth. Available pack sizes: 5g, 250mg, 10g, 1g.
3-[(2,6-dichlorophenyl)methylsulfanyl]-1H-1,2,4-triazol-5-amine (CAS 261928-97-6) is a chemical compound with the molecular formula C9H8Cl2N4S and a molecular weight of 275.16 g/mol. IUPAC name: 3-[(2,6-dichlorophenyl)methylsulfanyl]-1H-1,2,4-triazol-5-amine. InChIKey: QBRKGCKKPOXXRO-UHFFFAOYSA-N.
| Molecular formula | C9H8Cl2N4S |
|---|---|
| Molecular weight | 275.16 g/mol |
| IUPAC name | 3-[(2,6-dichlorophenyl)methylsulfanyl]-1H-1,2,4-triazol-5-amine |
| InChIKey | QBRKGCKKPOXXRO-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Cl)CSC2=NNC(=N2)N)Cl |
Computed by PubChem (NCBI)