CAS 261943-47-9 appears in our catalog under these names: 7-(Diethylamino)-3-(1H-imidazole-1-carbonyl)-2H-chromen-2-one, 98%, 7-(Diethylamino)-3-(imidazol-1-ylcarbonyl)-1-benzopyran-2-one. Offered by: Chemat Brand, Chemat. Available pack sizes: on request, 100mg, 1g.
7-(diethylamino)-3-(imidazole-1-carbonyl)chromen-2-one (CAS 261943-47-9) is a chemical compound with the molecular formula C17H17N3O3 and a molecular weight of 311.33 g/mol. IUPAC name: 7-(diethylamino)-3-(imidazole-1-carbonyl)chromen-2-one. InChIKey: HFXKNJHVXQURHV-UHFFFAOYSA-N.
| Molecular formula | C17H17N3O3 |
|---|---|
| Molecular weight | 311.33 g/mol |
| IUPAC name | 7-(diethylamino)-3-(imidazole-1-carbonyl)chromen-2-one |
| InChIKey | HFXKNJHVXQURHV-UHFFFAOYSA-N |
| SMILES | CCN(CC)C1=CC2=C(C=C1)C=C(C(=O)O2)C(=O)N3C=CN=C3 |
Computed by PubChem (NCBI)