CAS 2619563-79-8 appears in our catalog under these names: LYS–006 (hydrochloride), LYS006 (hydrochloride). Offered by: GLPBio, MedChemExpress. Available pack sizes: 1mg, 10mg, 25mg, 5mg, 25 mg, 5 mg, 1 mg, 10 mg.
(3S)-3-amino-4-[5-[4-[(5-chloro-3-fluoro-2-pyridinyl)oxy]phenyl]tetrazol-2-yl]butanoic acid;hydrochloride (CAS 2619563-79-8) is a chemical compound with the molecular formula C16H15Cl2FN6O3 and a molecular weight of 429.2 g/mol. IUPAC name: (3S)-3-amino-4-[5-[4-[(5-chloro-3-fluoro-2-pyridinyl)oxy]phenyl]tetrazol-2-yl]butanoic acid;hydrochloride. InChIKey: RNUBYUIOFFKDCJ-MERQFXBCSA-N.
| Molecular formula | C16H15Cl2FN6O3 |
|---|---|
| Molecular weight | 429.2 g/mol |
| IUPAC name | (3S)-3-amino-4-[5-[4-[(5-chloro-3-fluoro-2-pyridinyl)oxy]phenyl]tetrazol-2-yl]butanoic acid;hydrochloride |
| InChIKey | RNUBYUIOFFKDCJ-MERQFXBCSA-N |
| SMILES | C1=CC(=CC=C1C2=NN(N=N2)C[C@H](CC(=O)O)N)OC3=C(C=C(C=N3)Cl)F.Cl |
Computed by PubChem (NCBI)