CAS 26215-14-5 appears in our catalog under these names: 7–Amino–2H–1,4–benzoxazin–3(4H)one, 7-Amino-2H-1,4-benzoxazin-3[4H]one, 96%, 96%, 7-Amino-4H-benzo[1,4]oxazin-3-one, 98%, 7-Amino-2H-1,4-benzoxazin-3[4H]one, 96%. Offered by: GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g.
7-amino-4H-1,4-benzoxazin-3-one (CAS 26215-14-5) is a chemical compound with the molecular formula C8H8N2O2 and a molecular weight of 164.16 g/mol. IUPAC name: 7-amino-4H-1,4-benzoxazin-3-one. InChIKey: RUZXDTHZHJTTRO-UHFFFAOYSA-N.
| Molecular formula | C8H8N2O2 |
|---|---|
| Molecular weight | 164.16 g/mol |
| IUPAC name | 7-amino-4H-1,4-benzoxazin-3-one |
| InChIKey | RUZXDTHZHJTTRO-UHFFFAOYSA-N |
| SMILES | C1C(=O)NC2=C(O1)C=C(C=C2)N |
Computed by PubChem (NCBI)