Products 2621932-39-4
CAS 2621932-39-4 is the registry number for 8-((Triisopropylsilyl)ethynyl)naphthalene-1,3-diol, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
8-[2-tri(propan-2-yl)silylethynyl]naphthalene-1,3-diol (CAS 2621932-39-4) is a chemical compound with the molecular formula C21H28O2Si and a molecular weight of 340.5 g/mol. IUPAC name: 8-[2-tri(propan-2-yl)silylethynyl]naphthalene-1,3-diol. InChIKey: VGWGJHUIVKIDCG-UHFFFAOYSA-N.
| Molecular formula | C21H28O2Si |
|---|---|
| Molecular weight | 340.5 g/mol |
| IUPAC name | 8-[2-tri(propan-2-yl)silylethynyl]naphthalene-1,3-diol |
| InChIKey | VGWGJHUIVKIDCG-UHFFFAOYSA-N |
| SMILES | CC(C)[Si](C#CC1=CC=CC2=CC(=CC(=C21)O)O)(C(C)C)C(C)C |
Computed by PubChem (NCBI)