CAS 2621934-70-9 is the registry number for rel-((2R,7aS)-2-Methoxyhexahydro-1H-pyrrolizin-7a-yl)methanol, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.
[(2R,8S)-2-methoxy-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methanol (CAS 2621934-70-9) is a chemical compound with the molecular formula C9H17NO2 and a molecular weight of 171.24 g/mol. IUPAC name: [(2R,8S)-2-methoxy-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methanol. InChIKey: ITQZUBDIZPERSJ-BDAKNGLRSA-N.
| Molecular formula | C9H17NO2 |
|---|---|
| Molecular weight | 171.24 g/mol |
| IUPAC name | [(2R,8S)-2-methoxy-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methanol |
| InChIKey | ITQZUBDIZPERSJ-BDAKNGLRSA-N |
| SMILES | CO[C@@H]1C[C@@]2(CCCN2C1)CO |
Computed by PubChem (NCBI)