CAS 2621935-24-6 is the registry number for 8-Chloro-7-fluoro-3-(methoxymethoxy)naphthalen-1-yl trifluoromethanesulfonate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
[8-chloro-7-fluoro-3-(methoxymethoxy)naphthalen-1-yl] trifluoromethanesulfonate (CAS 2621935-24-6) is a chemical compound with the molecular formula C13H9ClF4O5S and a molecular weight of 388.72 g/mol. IUPAC name: [8-chloro-7-fluoro-3-(methoxymethoxy)naphthalen-1-yl] trifluoromethanesulfonate. InChIKey: PPGWZNCTUQVZAJ-UHFFFAOYSA-N.
| Molecular formula | C13H9ClF4O5S |
|---|---|
| Molecular weight | 388.72 g/mol |
| IUPAC name | [8-chloro-7-fluoro-3-(methoxymethoxy)naphthalen-1-yl] trifluoromethanesulfonate |
| InChIKey | PPGWZNCTUQVZAJ-UHFFFAOYSA-N |
| SMILES | COCOC1=CC(=C2C(=C1)C=CC(=C2Cl)F)OS(=O)(=O)C(F)(F)F |
Computed by PubChem (NCBI)