CAS 2621935-34-8 is the registry number for 7,8-Difluoro-3-(methoxymethoxy)naphthalen-1-yl trifluoromethanesulfonate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
[7,8-difluoro-3-(methoxymethoxy)naphthalen-1-yl] trifluoromethanesulfonate (CAS 2621935-34-8) is a chemical compound with the molecular formula C13H9F5O5S and a molecular weight of 372.27 g/mol. IUPAC name: [7,8-difluoro-3-(methoxymethoxy)naphthalen-1-yl] trifluoromethanesulfonate. InChIKey: RNHSGRKSCATSAN-UHFFFAOYSA-N.
| Molecular formula | C13H9F5O5S |
|---|---|
| Molecular weight | 372.27 g/mol |
| IUPAC name | [7,8-difluoro-3-(methoxymethoxy)naphthalen-1-yl] trifluoromethanesulfonate |
| InChIKey | RNHSGRKSCATSAN-UHFFFAOYSA-N |
| SMILES | COCOC1=CC(=C2C(=C1)C=CC(=C2F)F)OS(=O)(=O)C(F)(F)F |
Computed by PubChem (NCBI)