CAS 2621938-15-4 is the registry number for Methyl rel-(3S,7aS)-3-(fluoromethyl)tetrahydro-1H-pyrrolizine-7a(5H)-carboxylate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl (3S,8S)-3-(fluoromethyl)-1,2,3,5,6,7-hexahydropyrrolizine-8-carboxylate (CAS 2621938-15-4) is a chemical compound with the molecular formula C10H16FNO2 and a molecular weight of 201.24 g/mol. IUPAC name: methyl (3S,8S)-3-(fluoromethyl)-1,2,3,5,6,7-hexahydropyrrolizine-8-carboxylate. InChIKey: BGFIMWWKUUOFEQ-WPRPVWTQSA-N.
| Molecular formula | C10H16FNO2 |
|---|---|
| Molecular weight | 201.24 g/mol |
| IUPAC name | methyl (3S,8S)-3-(fluoromethyl)-1,2,3,5,6,7-hexahydropyrrolizine-8-carboxylate |
| InChIKey | BGFIMWWKUUOFEQ-WPRPVWTQSA-N |
| SMILES | COC(=O)[C@@]12CCCN1[C@@H](CC2)CF |
Computed by PubChem (NCBI)