CAS 2623-40-7 is the registry number for 1,3,6-Tribromo-2-Naphthalenol. Offered by: Chemat Brand. Available pack sizes: on request.
1,3,6-tribromonaphthalen-2-ol (CAS 2623-40-7) is a chemical compound with the molecular formula C10H5Br3O and a molecular weight of 380.86 g/mol. IUPAC name: 1,3,6-tribromonaphthalen-2-ol. InChIKey: PVXCVWLUJUMQQU-UHFFFAOYSA-N.
| Molecular formula | C10H5Br3O |
|---|---|
| Molecular weight | 380.86 g/mol |
| IUPAC name | 1,3,6-tribromonaphthalen-2-ol |
| InChIKey | PVXCVWLUJUMQQU-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C(C=C2C=C1Br)Br)O)Br |
Computed by PubChem (NCBI)