CAS 2623103-51-3 is the registry number for 3-(2,6-Dioxopiperidin-3-yl)benzo[d]isoxazole-5-sulfonyl chloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-(2,6-dioxopiperidin-3-yl)-1,2-benzoxazole-5-sulfonyl chloride (CAS 2623103-51-3) is a chemical compound with the molecular formula C12H9ClN2O5S and a molecular weight of 328.73 g/mol. IUPAC name: 3-(2,6-dioxopiperidin-3-yl)-1,2-benzoxazole-5-sulfonyl chloride. InChIKey: SSDMDGJUYCPZFT-UHFFFAOYSA-N.
| Molecular formula | C12H9ClN2O5S |
|---|---|
| Molecular weight | 328.73 g/mol |
| IUPAC name | 3-(2,6-dioxopiperidin-3-yl)-1,2-benzoxazole-5-sulfonyl chloride |
| InChIKey | SSDMDGJUYCPZFT-UHFFFAOYSA-N |
| SMILES | C1CC(=O)NC(=O)C1C2=NOC3=C2C=C(C=C3)S(=O)(=O)Cl |
Computed by PubChem (NCBI)