CAS 262376-41-0 is the registry number for 5-Ethynyl-2,3-dihydro-1H-inden-1-one. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
5-ethynyl-2,3-dihydroinden-1-one (CAS 262376-41-0) is a chemical compound with the molecular formula C11H8O and a molecular weight of 156.18 g/mol. IUPAC name: 5-ethynyl-2,3-dihydroinden-1-one. InChIKey: YSDHGTLYNPEPDD-UHFFFAOYSA-N.
| Molecular formula | C11H8O |
|---|---|
| Molecular weight | 156.18 g/mol |
| IUPAC name | 5-ethynyl-2,3-dihydroinden-1-one |
| InChIKey | YSDHGTLYNPEPDD-UHFFFAOYSA-N |
| SMILES | C#CC1=CC2=C(C=C1)C(=O)CC2 |
Computed by PubChem (NCBI)