CAS 2624-63-7 is the registry number for Coproporphyrinogen III. Offered by: Chemat Brand. Available pack sizes: on request.
Coproporphyrinogen III is a coproporphyrinogen. It has a role as a mouse metabolite and an Escherichia coli metabolite. It is a conjugate acid of a coproporphyrinogen III(4-).
Source: ChEBI
| Molecular formula | C36H44N4O8 |
|---|---|
| Molecular weight | 660.8 g/mol |
| IUPAC name | 3-[8,12,17-tris(2-carboxyethyl)-3,7,13,18-tetramethyl-5,10,15,20,21,22,23,24-octahydroporphyrin-2-yl]propanoic acid |
| InChIKey | NIUVHXTXUXOFEB-UHFFFAOYSA-N |
| SMILES | CC1=C2CC3=C(C(=C(N3)CC4=C(C(=C(N4)CC5=C(C(=C(N5)CC(=C1CCC(=O)O)N2)C)CCC(=O)O)C)CCC(=O)O)CCC(=O)O)C |
Computed by PubChem (NCBI)