CAS 2624108-59-2 is the registry number for (1S,5R)-3,8-Diazabicyclo(3.2.1)octan-2-one hydrochloride, 95%. Offered by: AmBeed. Available pack sizes: 1g, 250mg.
(1S,5R)-3,8-diazabicyclo[3.2.1]octan-2-one;hydrochloride (CAS 2624108-59-2) is a chemical compound with the molecular formula C6H11ClN2O and a molecular weight of 162.62 g/mol. IUPAC name: (1S,5R)-3,8-diazabicyclo[3.2.1]octan-2-one;hydrochloride. InChIKey: ZWEJRPZWECKAAK-JBUOLDKXSA-N.
| Molecular formula | C6H11ClN2O |
|---|---|
| Molecular weight | 162.62 g/mol |
| IUPAC name | (1S,5R)-3,8-diazabicyclo[3.2.1]octan-2-one;hydrochloride |
| InChIKey | ZWEJRPZWECKAAK-JBUOLDKXSA-N |
| SMILES | C1C[C@H]2C(=O)NC[C@@H]1N2.Cl |
Computed by PubChem (NCBI)