CAS 2624181-60-6 is the registry number for SHP2 ligand-3. Offered by: MedChemExpress. Available pack sizes: Get quote.
3-(2,3-dichlorophenyl)-6-[4-methyl-4-(prop-2-ynylamino)piperidin-1-yl]pyrazin-2-amine (CAS 2624181-60-6) is a chemical compound with the molecular formula C19H21Cl2N5 and a molecular weight of 390.3 g/mol. IUPAC name: 3-(2,3-dichlorophenyl)-6-[4-methyl-4-(prop-2-ynylamino)piperidin-1-yl]pyrazin-2-amine. InChIKey: FHEZPPVZSWQHIK-UHFFFAOYSA-N.
| Molecular formula | C19H21Cl2N5 |
|---|---|
| Molecular weight | 390.3 g/mol |
| IUPAC name | 3-(2,3-dichlorophenyl)-6-[4-methyl-4-(prop-2-ynylamino)piperidin-1-yl]pyrazin-2-amine |
| InChIKey | FHEZPPVZSWQHIK-UHFFFAOYSA-N |
| SMILES | CC1(CCN(CC1)C2=CN=C(C(=N2)N)C3=C(C(=CC=C3)Cl)Cl)NCC#C |
Computed by PubChem (NCBI)