Products 262429-48-1

CAS 262429-48-1 is the registry number for 3-(3-Chlorophenyl)-3-(2-phenylacetamido)propanoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.

Structural formula: {0} (CAS {1})

3-(3-chlorophenyl)-3-[(2-phenylacetyl)amino]propanoic acid (CAS 262429-48-1) is a chemical compound with the molecular formula C17H16ClNO3 and a molecular weight of 317.8 g/mol. IUPAC name: 3-(3-chlorophenyl)-3-[(2-phenylacetyl)amino]propanoic acid. InChIKey: KPNXJVGYPYRCHY-UHFFFAOYSA-N.

Identity
Molecular formulaC17H16ClNO3
Molecular weight317.8 g/mol
IUPAC name3-(3-chlorophenyl)-3-[(2-phenylacetyl)amino]propanoic acid
InChIKeyKPNXJVGYPYRCHY-UHFFFAOYSA-N
SMILESC1=CC=C(C=C1)CC(=O)NC(CC(=O)O)C2=CC(=CC=C2)Cl

Computed by PubChem (NCBI)