Products 262433-23-8
CAS 262433-23-8 is the registry number for tert-Butyl (2-methoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl)carbamate, 98%. Offered by: Fluorochem. Available pack sizes: 25mg, 50mg, 100mg.
Tert-butyl N-[2-methoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]carbamate (CAS 262433-23-8) is a chemical compound with the molecular formula C18H28BNO5 and a molecular weight of 349.2 g/mol. IUPAC name: tert-butyl N-[2-methoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]carbamate. InChIKey: RTEJGMDKEZSLPH-UHFFFAOYSA-N.
| Molecular formula | C18H28BNO5 |
|---|---|
| Molecular weight | 349.2 g/mol |
| IUPAC name | tert-butyl N-[2-methoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]carbamate |
| InChIKey | RTEJGMDKEZSLPH-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=C(C=C2)OC)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)