Products 262433-28-3
CAS 262433-28-3 is the registry number for Trt-butyl (4-bromo-3-methoxyphenyl)carbamate, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
Tert-butyl N-(4-bromo-3-methoxyphenyl)carbamate (CAS 262433-28-3) is a chemical compound with the molecular formula C12H16BrNO3 and a molecular weight of 302.16 g/mol. IUPAC name: tert-butyl N-(4-bromo-3-methoxyphenyl)carbamate. InChIKey: FVRFUTSYZGORBM-UHFFFAOYSA-N.
| Molecular formula | C12H16BrNO3 |
|---|---|
| Molecular weight | 302.16 g/mol |
| IUPAC name | tert-butyl N-(4-bromo-3-methoxyphenyl)carbamate |
| InChIKey | FVRFUTSYZGORBM-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1=CC(=C(C=C1)Br)OC |
Computed by PubChem (NCBI)