Products 262444-08-6

CAS 262444-08-6 is the registry number for Oxan-4-yl trifluoromethanesulfonate. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

Oxan-4-yl trifluoromethanesulfonate (CAS 262444-08-6) is a chemical compound with the molecular formula C6H9F3O4S and a molecular weight of 234.20 g/mol. IUPAC name: oxan-4-yl trifluoromethanesulfonate. InChIKey: RHTYPJAOPJSRAJ-UHFFFAOYSA-N.

Identity
Molecular formulaC6H9F3O4S
Molecular weight234.20 g/mol
IUPAC nameoxan-4-yl trifluoromethanesulfonate
InChIKeyRHTYPJAOPJSRAJ-UHFFFAOYSA-N
SMILESC1COCCC1OS(=O)(=O)C(F)(F)F

Computed by PubChem (NCBI)