CAS 26245-59-0 is the registry number for 2-Hydrazinyl-5-nitrothiazole, 97%. Offered by: AmBeed. Available pack sizes: 250mg.
(5-nitro-1,3-thiazol-2-yl)hydrazine (CAS 26245-59-0) is a chemical compound with the molecular formula C3H4N4O2S and a molecular weight of 160.16 g/mol. IUPAC name: (5-nitro-1,3-thiazol-2-yl)hydrazine. InChIKey: RQFVSOCSUVIZHL-UHFFFAOYSA-N.
| Molecular formula | C3H4N4O2S |
|---|---|
| Molecular weight | 160.16 g/mol |
| IUPAC name | (5-nitro-1,3-thiazol-2-yl)hydrazine |
| InChIKey | RQFVSOCSUVIZHL-UHFFFAOYSA-N |
| SMILES | C1=C(SC(=N1)NN)[N+](=O)[O-] |
Computed by PubChem (NCBI)