CAS 262451-89-8 appears in our catalog under these names: SC 22716, 98%, SC 22716, SC-22716/ 99.91% (existing batch purity), SC 22716, 98%, 98%, SC-22716. Offered by: Chemat Brand, TRC, TargetMol, Chemat, MedChemExpress. Available pack sizes: on request, 50mg, 1mg, 5mg, 10mg, 25mg, 100mg, 1 mg.
1-[2-(4-phenylphenoxy)ethyl]pyrrolidine (CAS 262451-89-8) is a chemical compound with the molecular formula C18H21NO and a molecular weight of 267.4 g/mol. IUPAC name: 1-[2-(4-phenylphenoxy)ethyl]pyrrolidine. InChIKey: PKUGRVAJRGZDJP-UHFFFAOYSA-N.
| Molecular formula | C18H21NO |
|---|---|
| Molecular weight | 267.4 g/mol |
| IUPAC name | 1-[2-(4-phenylphenoxy)ethyl]pyrrolidine |
| InChIKey | PKUGRVAJRGZDJP-UHFFFAOYSA-N |
| SMILES | C1CCN(C1)CCOC2=CC=C(C=C2)C3=CC=CC=C3 |
Computed by PubChem (NCBI)