CAS 262603-24-7 is the registry number for Sodium 2-(2-(hydroxymethyl)phenyl)acetate. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
Sodium 2-[2-(hydroxymethyl)phenyl]acetate (CAS 262603-24-7) is a chemical compound with the molecular formula C9H9NaO3 and a molecular weight of 188.16 g/mol. IUPAC name: sodium 2-[2-(hydroxymethyl)phenyl]acetate. InChIKey: MHEMJFGMYQGYAN-UHFFFAOYSA-M.
| Molecular formula | C9H9NaO3 |
|---|---|
| Molecular weight | 188.16 g/mol |
| IUPAC name | sodium 2-[2-(hydroxymethyl)phenyl]acetate |
| InChIKey | MHEMJFGMYQGYAN-UHFFFAOYSA-M |
| SMILES | C1=CC=C(C(=C1)CC(=O)[O-])CO.[Na+] |
Computed by PubChem (NCBI)