CAS 2627-97-6 appears in our catalog under these names: 1,3-Divinyl-1,3-diphenyl-1,3-dimethyldisiloxane, 98%, 1,3–Dimethyl–1,3–diphenyl–1,3–divinyldisiloxane, 1,3-Dimethyl-1,3-diphenyl-1,3-divinyldisiloxane, >98.0%(GC), 1,3-Diethenyl-1,3-dimethyl-1,3-diphenyldisiloxane, 95% mix TBC as stabilizer, 95% mix TBC as stabilizer. Offered by: Combi-blocks, GLPBio, TCI, Chemat, Fluorochem. Available pack sizes: 1g, 25g, 5g, 10g.
Ethenyl-(ethenyl-methyl-phenylsilyl)oxy-methyl-phenylsilane (CAS 2627-97-6) is a chemical compound with the molecular formula C18H22OSi2 and a molecular weight of 310.5 g/mol. IUPAC name: ethenyl-(ethenyl-methyl-phenylsilyl)oxy-methyl-phenylsilane. InChIKey: KPWVUBSQUODFPP-UHFFFAOYSA-N.
| Molecular formula | C18H22OSi2 |
|---|---|
| Molecular weight | 310.5 g/mol |
| IUPAC name | ethenyl-(ethenyl-methyl-phenylsilyl)oxy-methyl-phenylsilane |
| InChIKey | KPWVUBSQUODFPP-UHFFFAOYSA-N |
| SMILES | C[Si](C=C)(C1=CC=CC=C1)O[Si](C)(C=C)C2=CC=CC=C2 |
Computed by PubChem (NCBI)