Products 26275-88-7
CAS 26275-88-7 appears in our catalog under these names: 2,2,6,6-Tetramethylpiperidin-4-yl benzoate, 97%, 2,2,6,6-Tetramethylpiperidin-4-yl benzoate, 98%. Offered by: Ambeed, BLDpharm, Fluorochem, Chemat. Available pack sizes: 250mg, 1g, 5g, 100mg.
(2,2,6,6-tetramethylpiperidin-4-yl) benzoate (CAS 26275-88-7) is a chemical compound with the molecular formula C16H23NO2 and a molecular weight of 261.36 g/mol. IUPAC name: (2,2,6,6-tetramethylpiperidin-4-yl) benzoate. InChIKey: YEYCMBWKTZNPDH-UHFFFAOYSA-N.
| Molecular formula | C16H23NO2 |
|---|---|
| Molecular weight | 261.36 g/mol |
| IUPAC name | (2,2,6,6-tetramethylpiperidin-4-yl) benzoate |
| InChIKey | YEYCMBWKTZNPDH-UHFFFAOYSA-N |
| SMILES | CC1(CC(CC(N1)(C)C)OC(=O)C2=CC=CC=C2)C |
Computed by PubChem (NCBI)
Synonyms:
2,2,6,6-tetramethyl-4-piperidyl benzoate, 2,2,6,6-tetramethylpiperidin-4-yl benzoate, 4-Piperidinol, 2,2,6,6-tetramethyl-, 4-benzoate, (2,2,6,6-tetramethylpiperidin-4-yl) benzoate, Benzoic acid 2,2,6,6-tetramethyl-piperidin-4-yl ester, 4-benzoyloxy-2,2,6,6-tetramethylpiperidine, ChemDiv2_000227, Oprea1_477012, Oprea1_498269, Benzoic acid 2,2,6,6-tetramethyl-4-piperidinyl ester