CAS 2628352-23-6 is the registry number for tert-Butyl 4-amino-7-chloro-1,1-dimethyl-3-oxoisoindoline-2-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl 4-amino-7-chloro-1,1-dimethyl-3-oxoisoindole-2-carboxylate (CAS 2628352-23-6) is a chemical compound with the molecular formula C15H19ClN2O3 and a molecular weight of 310.77 g/mol. IUPAC name: tert-butyl 4-amino-7-chloro-1,1-dimethyl-3-oxoisoindole-2-carboxylate. InChIKey: MBBMOGXJBFNQBR-UHFFFAOYSA-N.
| Molecular formula | C15H19ClN2O3 |
|---|---|
| Molecular weight | 310.77 g/mol |
| IUPAC name | tert-butyl 4-amino-7-chloro-1,1-dimethyl-3-oxoisoindole-2-carboxylate |
| InChIKey | MBBMOGXJBFNQBR-UHFFFAOYSA-N |
| SMILES | CC1(C2=C(C=CC(=C2C(=O)N1C(=O)OC(C)(C)C)N)Cl)C |
Computed by PubChem (NCBI)