CAS 262854-35-3 is the registry number for Didesmethyl (alphaR)-Sibutramine Hydrochloride. Offered by: TRC. Available pack sizes: 250mg.
(1R)-1-[1-(4-chlorophenyl)cyclobutyl]-3-methylbutan-1-amine;hydrochloride (CAS 262854-35-3) is a chemical compound with the molecular formula C15H23Cl2N and a molecular weight of 288.3 g/mol. IUPAC name: (1R)-1-[1-(4-chlorophenyl)cyclobutyl]-3-methylbutan-1-amine;hydrochloride. InChIKey: KHRVYINTXCWNRF-PFEQFJNWSA-N.
| Molecular formula | C15H23Cl2N |
|---|---|
| Molecular weight | 288.3 g/mol |
| IUPAC name | (1R)-1-[1-(4-chlorophenyl)cyclobutyl]-3-methylbutan-1-amine;hydrochloride |
| InChIKey | KHRVYINTXCWNRF-PFEQFJNWSA-N |
| SMILES | CC(C)C[C@H](C1(CCC1)C2=CC=C(C=C2)Cl)N.Cl |
Computed by PubChem (NCBI)