CAS 2629316-00-1 is the registry number for 4-Bromo-2-(carboxycarbonyl)benzoic acid, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
4-bromo-2-oxalobenzoic acid (CAS 2629316-00-1) is a chemical compound with the molecular formula C9H5BrO5 and a molecular weight of 273.04 g/mol. IUPAC name: 4-bromo-2-oxalobenzoic acid. InChIKey: HXMQBODQAMPOBC-UHFFFAOYSA-N.
| Molecular formula | C9H5BrO5 |
|---|---|
| Molecular weight | 273.04 g/mol |
| IUPAC name | 4-bromo-2-oxalobenzoic acid |
| InChIKey | HXMQBODQAMPOBC-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Br)C(=O)C(=O)O)C(=O)O |
Computed by PubChem (NCBI)