CAS 26305-08-8 is the registry number for 1-Methyl-1nitro-2- Nitrosoguanidine. Offered by: Chemat Brand. Available pack sizes: on request.
1-methyl-1-nitro-2-nitrosoguanidine (CAS 26305-08-8) is a chemical compound with the molecular formula C2H5N5O3 and a molecular weight of 147.09 g/mol. IUPAC name: 1-methyl-1-nitro-2-nitrosoguanidine. InChIKey: UKIDUMMXBQMTKO-UHFFFAOYSA-N.
| Molecular formula | C2H5N5O3 |
|---|---|
| Molecular weight | 147.09 g/mol |
| IUPAC name | 1-methyl-1-nitro-2-nitrosoguanidine |
| InChIKey | UKIDUMMXBQMTKO-UHFFFAOYSA-N |
| SMILES | CN(/C(=N/N=O)/N)[N+](=O)[O-] |
Computed by PubChem (NCBI)