CAS 2630939-88-5 is the registry number for 3,3',5,5'-Tetra(1H-pyrazol-4-yl)-1,1'-biphenyl, 95%. Offered by: Chemat Brand, Ambeed. Available pack sizes: on request, 100mg, 250mg, 1g.
4-[3-[3,5-bis(1H-pyrazol-4-yl)phenyl]-5-(1H-pyrazol-4-yl)phenyl]-1H-pyrazole (CAS 2630939-88-5) is a chemical compound with the molecular formula C24H18N8 and a molecular weight of 418.5 g/mol. IUPAC name: 4-[3-[3,5-bis(1H-pyrazol-4-yl)phenyl]-5-(1H-pyrazol-4-yl)phenyl]-1H-pyrazole. InChIKey: LALVHKWHNFYOMH-UHFFFAOYSA-N.
| Molecular formula | C24H18N8 |
|---|---|
| Molecular weight | 418.5 g/mol |
| IUPAC name | 4-[3-[3,5-bis(1H-pyrazol-4-yl)phenyl]-5-(1H-pyrazol-4-yl)phenyl]-1H-pyrazole |
| InChIKey | LALVHKWHNFYOMH-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1C2=CNN=C2)C3=CNN=C3)C4=CC(=CC(=C4)C5=CNN=C5)C6=CNN=C6 |
Computed by PubChem (NCBI)