CAS 2631059-86-2 is the registry number for 1-(6-Iodobenzofuran-3-yl)dihydropyrimidine-2,4(1H,3H)-dione, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1-(6-iodo-1-benzofuran-3-yl)-1,3-diazinane-2,4-dione (CAS 2631059-86-2) is a chemical compound with the molecular formula C12H9IN2O3 and a molecular weight of 356.12 g/mol. IUPAC name: 1-(6-iodo-1-benzofuran-3-yl)-1,3-diazinane-2,4-dione. InChIKey: CHILMLNPXLXROA-UHFFFAOYSA-N.
| Molecular formula | C12H9IN2O3 |
|---|---|
| Molecular weight | 356.12 g/mol |
| IUPAC name | 1-(6-iodo-1-benzofuran-3-yl)-1,3-diazinane-2,4-dione |
| InChIKey | CHILMLNPXLXROA-UHFFFAOYSA-N |
| SMILES | C1CN(C(=O)NC1=O)C2=COC3=C2C=CC(=C3)I |
Computed by PubChem (NCBI)