CAS 26315-32-2 is the registry number for 2',3'-Dideoxyadenosine-5'-monophosphate. Offered by: Biosynth. Available pack sizes: 100mg, 25mg.
[(2S,5R)-5-(6-aminopurin-9-yl)oxolan-2-yl]methyl dihydrogen phosphate (CAS 26315-32-2) is a chemical compound with the molecular formula C10H14N5O5P and a molecular weight of 315.22 g/mol. IUPAC name: [(2S,5R)-5-(6-aminopurin-9-yl)oxolan-2-yl]methyl dihydrogen phosphate. InChIKey: PUSXDQXVJDGIBK-NKWVEPMBSA-N.
| Molecular formula | C10H14N5O5P |
|---|---|
| Molecular weight | 315.22 g/mol |
| IUPAC name | [(2S,5R)-5-(6-aminopurin-9-yl)oxolan-2-yl]methyl dihydrogen phosphate |
| InChIKey | PUSXDQXVJDGIBK-NKWVEPMBSA-N |
| SMILES | C1C[C@@H](O[C@@H]1COP(=O)(O)O)N2C=NC3=C(N=CN=C32)N |
Computed by PubChem (NCBI)