Products 2632308-04-2
CAS 2632308-04-2 is the registry number for E3 ligase Ligand-Linker Conjugate 39. Offered by: MedChemExpress. Available pack sizes: Get quote.
Tert-butyl 4-[1-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]azetidin-3-yl]piperazine-1-carboxylate (CAS 2632308-04-2) is a chemical compound with the molecular formula C25H31N5O6 and a molecular weight of 497.5 g/mol. IUPAC name: tert-butyl 4-[1-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]azetidin-3-yl]piperazine-1-carboxylate. InChIKey: NGYIRGJPUYZROX-UHFFFAOYSA-N.
| Molecular formula | C25H31N5O6 |
|---|---|
| Molecular weight | 497.5 g/mol |
| IUPAC name | tert-butyl 4-[1-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]azetidin-3-yl]piperazine-1-carboxylate |
| InChIKey | NGYIRGJPUYZROX-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCN(CC1)C2CN(C2)C3=CC4=C(C=C3)C(=O)N(C4=O)C5CCC(=O)NC5=O |
Computed by PubChem (NCBI)
Synonyms:
E3 ligase Ligand-Linker Conjugate 39, orb2566364