CAS 26328-04-1 appears in our catalog under these names: Cinepazide Maleate, Cinepazide maleate/ 99.9%, Cinepazide maleate, Cinepazide Maleate, >98.0%(HPLC)(T), Cinepazide Maleate 99% (HPLC). Offered by: Chemat Brand, TRC, TargetMol, GLPBio, TCI. Available pack sizes: on request, 50mg, 10mg, 25mg, 100mg, 200mg, 500mg, 250mg.
(Z)-but-2-enedioic acid;(E)-1-[4-(2-oxo-2-pyrrolidin-1-ylethyl)piperazin-1-yl]-3-(3,4,5-trimethoxyphenyl)prop-2-en-1-one (CAS 26328-04-1) is a chemical compound with the molecular formula C26H35N3O9 and a molecular weight of 533.6 g/mol. IUPAC name: (Z)-but-2-enedioic acid;(E)-1-[4-(2-oxo-2-pyrrolidin-1-ylethyl)piperazin-1-yl]-3-(3,4,5-trimethoxyphenyl)prop-2-en-1-one. InChIKey: XSTJTOKYCAJVMJ-GVTSEVKNSA-N.
| Molecular formula | C26H35N3O9 |
|---|---|
| Molecular weight | 533.6 g/mol |
| IUPAC name | (Z)-but-2-enedioic acid;(E)-1-[4-(2-oxo-2-pyrrolidin-1-ylethyl)piperazin-1-yl]-3-(3,4,5-trimethoxyphenyl)prop-2-en-1-one |
| InChIKey | XSTJTOKYCAJVMJ-GVTSEVKNSA-N |
| SMILES | COC1=CC(=CC(=C1OC)OC)/C=C/C(=O)N2CCN(CC2)CC(=O)N3CCCC3.C(=C\C(=O)O)\C(=O)O |
Computed by PubChem (NCBI)